Introduction:Basic information about CAS 215930-42-0|Estradiol and medroxyprogesterone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Estradiol and medroxyprogesterone |
|---|
| CAS Number | 215930-42-0 | Molecular Weight | 616.9 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C40H56O5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | Estradiol and medroxyprogesterone |
|---|
Chemical & Physical Properties
| Molecular Formula | C40H56O5 |
|---|
| Molecular Weight | 616.9 |
|---|
| InChIKey | DWYULUXRGTXBDW-PZRUWWKQSA-N |
|---|
| SMILES | CC(=O)C1(O)CCC2C3CC(C)C4=CC(=O)CCC4(C)C3CCC21C.CC12CCC3c4ccc(O)cc4CCC3C1CCC2O |
|---|