Introduction：Basic information about CAS 73347-92-9|Hexazinone mixt. with diuron, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Hexazinone mixt. with diuron |
|---|
| CAS Number | 73347-92-9 | Molecular Weight | 485.4 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C21H30Cl2N6O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | Hexazinone mixt. with diuron |
|---|
Chemical & Physical Properties
| Molecular Formula | C21H30Cl2N6O3 |
|---|
| Molecular Weight | 485.4 |
|---|
| InChIKey | JCGNKKHODNOFKU-UHFFFAOYSA-N |
|---|
| SMILES | CN(C)C(=O)Nc1ccc(Cl)c(Cl)c1.CN(C)c1nc(=O)n(C2CCCCC2)c(=O)n1C |
|---|
