Introduction:Basic information about CAS 1215574-59-6|1-(3-Chlorophenyl)cyclopentanamine hydrochloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-(3-Chlorophenyl)cyclopentanamine hydrochloride |
|---|
| CAS Number | 1215574-59-6 | Molecular Weight | 232.15 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C11H15Cl2N | Melting Point | / |
|---|
| MSDS | USA | Flash Point | / |
|---|
| Symbol | GHS05 | Signal Word | Danger |
|---|
Names
| Name | 1-(3-Chlorophenyl)cyclopentanamine hydrochloride |
|---|
Chemical & Physical Properties
| Molecular Formula | C11H15Cl2N |
|---|
| Molecular Weight | 232.15 |
|---|
| InChIKey | GSIRZTWXMWPVLF-UHFFFAOYSA-N |
|---|
| SMILES | Cl.NC1(c2cccc(Cl)c2)CCCC1 |
|---|
Safety Information
| Symbol | GHS05 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H318 |
|---|
| Precautionary Statements | P280-P305 + P351 + P338 |
|---|
| RIDADR | NONH for all modes of transport |
|---|