Introduction:Basic information about CAS 916791-92-9|1-Piperidinecarboxylic acid, 4-oxo-, anhydride with benzoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-Piperidinecarboxylic acid, 4-oxo-, anhydride with benzoic acid |
|---|
| CAS Number | 916791-92-9 | Molecular Weight | 247.25 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C13H13NO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 1-Piperidinecarboxylic acid, 4-oxo-, anhydride with benzoic acid |
|---|
Chemical & Physical Properties
| Molecular Formula | C13H13NO4 |
|---|
| Molecular Weight | 247.25 |
|---|
| InChIKey | TWBTXDGXTZAICT-UHFFFAOYSA-N |
|---|
| SMILES | O=C1CCN(C(=O)OC(=O)c2ccccc2)CC1 |
|---|