Introduction:Basic information about CAS 53803-13-7|N,N,N-Trimethylmethanaminium salt with 2,2-dimethylpropanoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N,N,N-Trimethylmethanaminium salt with 2,2-dimethylpropanoic acid |
|---|
| CAS Number | 53803-13-7 | Molecular Weight | 175.27 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C9H21NO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | N,N,N-Trimethylmethanaminium salt with 2,2-dimethylpropanoic acid |
|---|
Chemical & Physical Properties
| Molecular Formula | C9H21NO2 |
|---|
| Molecular Weight | 175.27 |
|---|
| InChIKey | VQLNWBFHYYUMGE-UHFFFAOYSA-M |
|---|
| SMILES | CC(C)(C)C(=O)[O-].C[N+](C)(C)C |
|---|