Introduction:Basic information about CAS 40630-34-0|Arsonium, tetraphenyl-, salt with 1,1,2,2,3,3,4,4,4-nonafluoro-4-butanesulfinic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Arsonium, tetraphenyl-, salt with 1,1,2,2,3,3,4,4,4-nonafluoro-4-butanesulfinic acid (1:1) |
|---|
| CAS Number | 40630-34-0 | Molecular Weight | 666.4 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C28H20AsF9O2S | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | Arsonium, tetraphenyl-, salt with 1,1,2,2,3,3,4,4,4-nonafluoro-4-butanesulfinic acid (1:1) |
|---|
Chemical & Physical Properties
| Molecular Formula | C28H20AsF9O2S |
|---|
| Molecular Weight | 666.4 |
|---|
| InChIKey | JVMIVRONIVOWMP-UHFFFAOYSA-M |
|---|
| SMILES | O=S([O-])C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.c1ccc([As+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
|---|