Introduction:Basic information about CAS 1276197-39-7|alpha-Hydroxymetoprolol-d7 (iso-propyl-d7) (mixture of stereoisomers), including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | alpha-Hydroxymetoprolol-d7 (iso-propyl-d7) (mixture of stereoisomers) |
|---|
| CAS Number | 1276197-39-7 | Molecular Weight | 290.41 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C15H25NO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | alpha-Hydroxymetoprolol-d7 (iso-propyl-d7) (mixture of stereoisomers) |
|---|
Chemical & Physical Properties
| Molecular Formula | C15H25NO4 |
|---|
| Molecular Weight | 290.41 |
|---|
| InChIKey | OFRYBPCSEMMZHR-UENXPIBQSA-N |
|---|
| SMILES | COCC(O)c1ccc(OCC(O)CNC(C)C)cc1 |
|---|