Introduction:Basic information about CAS 6829-23-8|Benzenecarbothioic acid, anhydrosulfide with N-(phenylmethyl)carbamodithioic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Benzenecarbothioic acid, anhydrosulfide with N-(phenylmethyl)carbamodithioic acid |
|---|
| CAS Number | 6829-23-8 | Molecular Weight | 287.4 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C15H13NOS2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | Benzenecarbothioic acid, anhydrosulfide with N-(phenylmethyl)carbamodithioic acid |
|---|
Chemical & Physical Properties
| Molecular Formula | C15H13NOS2 |
|---|
| Molecular Weight | 287.4 |
|---|
| InChIKey | PVEVLCKAFBSIGB-UHFFFAOYSA-N |
|---|
| SMILES | O=C(SC(=S)NCc1ccccc1)c1ccccc1 |
|---|