Introduction：Basic information about CAS 59316-81-3|N'-(3,4-Dichlorophenyl)-N-methoxy-N-methylurea mixt. with N-(1-ethylpropyl)-3,4-d, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N'-(3,4-Dichlorophenyl)-N-methoxy-N-methylurea mixt. with N-(1-ethylpropyl)-3,4-dimethyl-2,6-dinitrobenzenamine |
|---|
| CAS Number | 59316-81-3 | Molecular Weight | 530.4 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C22H29Cl2N5O6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | N'-(3,4-Dichlorophenyl)-N-methoxy-N-methylurea mixt. with N-(1-ethylpropyl)-3,4-dimethyl-2,6-dinitrobenzenamine |
|---|
Chemical & Physical Properties
| Molecular Formula | C22H29Cl2N5O6 |
|---|
| Molecular Weight | 530.4 |
|---|
| InChIKey | LZDZRUVDMIAHDW-UHFFFAOYSA-N |
|---|
| SMILES | CCC(CC)Nc1c([N+](=O)[O-])cc(C)c(C)c1[N+](=O)[O-].CON(C)C(=O)Nc1ccc(Cl)c(Cl)c1 |
|---|
