Introduction:Basic information about CAS 70221-65-7|Simetryn mixt. with MCPA-thioethyl, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Simetryn mixt. with MCPA-thioethyl |
|---|
| CAS Number | 70221-65-7 | Molecular Weight | 458.0 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C19H28ClN5O2S2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | Simetryn mixt. with MCPA-thioethyl |
|---|
Chemical & Physical Properties
| Molecular Formula | C19H28ClN5O2S2 |
|---|
| Molecular Weight | 458.0 |
|---|
| InChIKey | YBAZSGZRRLPIHK-UHFFFAOYSA-N |
|---|
| SMILES | CCNc1nc(NCC)nc(SC)n1.CCSC(=O)COc1ccc(Cl)cc1C |
|---|