Introduction:Basic information about CAS 113772-57-9|Cyclopropanecarboxylic acid, 3-(2,2-dibromoethenyl)-2,2-dimethyl-, (S)-cyano(3-pheno, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Cyclopropanecarboxylic acid, 3-(2,2-dibromoethenyl)-2,2-dimethyl-, (S)-cyano(3-phenoxyphenyl)methyl ester, (1R,3R)-, mixt. with 2-[(1,1-dimethylethyl)imino]tetrahydro-3-(1-methylethyl)-5-phenyl-4H-1,3,5-thiadiazin-4-one |
|---|
| CAS Number | 113772-57-9 | Molecular Weight | 810.6 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C38H42Br2N4O4S | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | Cyclopropanecarboxylic acid, 3-(2,2-dibromoethenyl)-2,2-dimethyl-, (S)-cyano(3-phenoxyphenyl)methyl ester, (1R,3R)-, mixt. with 2-[(1,1-dimethylethyl)imino]tetrahydro-3-(1-methylethyl)-5-phenyl-4H-1,3,5-thiadiazin-4-one |
|---|
Chemical & Physical Properties
| Molecular Formula | C38H42Br2N4O4S |
|---|
| Molecular Weight | 810.6 |
|---|
| InChIKey | DAMHECRFCXJQAG-LLSKDXDJSA-N |
|---|
| SMILES | CC(C)N1C(=O)N(c2ccccc2)CSC1=NC(C)(C)C.CC1(C)C(C=C(Br)Br)C1C(=O)OC(C#N)c1cccc(Oc2ccccc2)c1 |
|---|