Introduction：Basic information about CAS 909261-64-9|Penicillin G, peptide with lysine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Penicillin G, peptide with lysine |
|---|
| CAS Number | 909261-64-9 | Molecular Weight | 462.6 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C22H30N4O5S | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | Penicillin G, peptide with lysine |
|---|
Chemical & Physical Properties
| Molecular Formula | C22H30N4O5S |
|---|
| Molecular Weight | 462.6 |
|---|
| InChIKey | CVXJTLRJPAKXIT-DZIWXPPMSA-N |
|---|
| SMILES | CC1(C)SC2C(NC(=O)Cc3ccccc3)C(=O)N2C1C(=O)NCCCCC(N)C(=O)O |
|---|
