Introduction：Basic information about CAS 19870-47-4|4-Thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid, 3,3-dimethyl-7-oxo-6-[(phenylace, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-Thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid, 3,3-dimethyl-7-oxo-6-[(phenylacetyl)amino]-(2S,5R,6R)-, anhydride with ethyl hydrogen carbonate |
|---|
| CAS Number | 19870-47-4 | Molecular Weight | 406.5 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C19H22N2O6S | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 4-Thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid, 3,3-dimethyl-7-oxo-6-[(phenylacetyl)amino]-(2S,5R,6R)-, anhydride with ethyl hydrogen carbonate |
|---|
Chemical & Physical Properties
| Molecular Formula | C19H22N2O6S |
|---|
| Molecular Weight | 406.5 |
|---|
| InChIKey | COYWEDJRUHQFAE-IJEWVQPXSA-N |
|---|
| SMILES | CCOC(=O)OC(=O)C1N2C(=O)C(NC(=O)Cc3ccccc3)C2SC1(C)C |
|---|
