Introduction：Basic information about CAS 1236479-65-4|[1,1'-Biphenyl]-4-propanoic acid,-(acetylamino)-, (R)-, compd. with (S)--methyl, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | [1,1'-Biphenyl]-4-propanoic acid,-(acetylamino)-, (R)-, compd. with (S)--methylbenzenemethanamine (1:1) |
|---|
| CAS Number | 1236479-65-4 | Molecular Weight | 404.5 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C25H28N2O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | [1,1'-Biphenyl]-4-propanoic acid,-(acetylamino)-, (R)-, compd. with (S)--methylbenzenemethanamine (1:1) |
|---|
Chemical & Physical Properties
| Molecular Formula | C25H28N2O3 |
|---|
| Molecular Weight | 404.5 |
|---|
| InChIKey | WYHQNARLQZAQMM-NDOMUHJGSA-N |
|---|
| SMILES | CC(=O)NC(Cc1ccc(-c2ccccc2)cc1)C(=O)O.CC(N)c1ccccc1 |
|---|
