Introduction:Basic information about CAS 126049-00-1|Tributyl(2-methoxypropyl)phosphonium salt with 4,4a(2)-[2,2,2-trifluoro-1-(trifluoro, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Tributyl(2-methoxypropyl)phosphonium salt with 4,4a(2)-[2,2,2-trifluoro-1-(trifluoromethyl)ethylidene]bis[phenol] (1:1) |
|---|
| CAS Number | 126049-00-1 | Molecular Weight | 610.6 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C31H45F6O3P | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | Tributyl(2-methoxypropyl)phosphonium salt with 4,4a(2)-[2,2,2-trifluoro-1-(trifluoromethyl)ethylidene]bis[phenol] (1:1) |
|---|
Chemical & Physical Properties
| Molecular Formula | C31H45F6O3P |
|---|
| Molecular Weight | 610.6 |
|---|
| InChIKey | BEDFWSDWODSANM-UHFFFAOYSA-M |
|---|
| SMILES | CCCC[P+](CCCC)(CCCC)CC(C)OC.[O-]c1ccc(C(c2ccc(O)cc2)(C(F)(F)F)C(F)(F)F)cc1 |
|---|