Introduction:Basic information about CAS 1248347-61-6|Dichlorobis(3,7-diacetyl-1,3,7-triaza-5-phosphabicyclo[3.3.1]nonane) palladium(II), including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Dichlorobis(3,7-diacetyl-1,3,7-triaza-5-phosphabicyclo[3.3.1]nonane) palladium(II) |
|---|
| CAS Number | 1248347-61-6 | Molecular Weight | 635.8 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C18H32Cl2N6O4P2Pd | Melting Point | / |
|---|
| MSDS | USA | Flash Point | / |
|---|
Names
| Name | Dichlorobis(3,7-diacetyl-1,3,7-triaza-5-phosphabicyclo[3.3.1]nonane) palladium(II) |
|---|
Chemical & Physical Properties
| Molecular Formula | C18H32Cl2N6O4P2Pd |
|---|
| Molecular Weight | 635.8 |
|---|
| InChIKey | WGZZREUHMBLQPM-UHFFFAOYSA-L |
|---|
| SMILES | CC(=O)N1CN2CN(C(C)=O)CP(C2)C1.CC(=O)N1CN2CN(C(C)=O)CP(C2)C1.Cl[Pd]Cl |
|---|
Safety Information
| RIDADR | NONH for all modes of transport |
|---|