Introduction：Basic information about CAS 1454306-53-6|m-Hydroxy metabolite of lacosamide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | m-Hydroxy metabolite of lacosamide |
|---|
| CAS Number | 1454306-53-6 | Molecular Weight | 266.29 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C13H18N2O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | m-Hydroxy metabolite of lacosamide |
|---|
Chemical & Physical Properties
| Molecular Formula | C13H18N2O4 |
|---|
| Molecular Weight | 266.29 |
|---|
| InChIKey | FQQWQUOPPYPDRC-GFCCVEGCSA-N |
|---|
| SMILES | COCC(NC(C)=O)C(=O)NCc1cccc(O)c1 |
|---|
