Introduction:Basic information about CAS 200443-98-7|Boron sodium oxide (B5NaO8), labeled with boron-10, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Boron sodium oxide (B5NaO8), labeled with boron-10 |
|---|
| CAS Number | 200443-98-7 | Molecular Weight | 201.05 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | B5NaO8 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | Boron sodium oxide (B5NaO8), labeled with boron-10 |
|---|
Chemical & Physical Properties
| Molecular Formula | B5NaO8 |
|---|
| Molecular Weight | 201.05 |
|---|
| InChIKey | OFWHLDSMUYNYEZ-WYQORLDKSA-N |
|---|
| SMILES | [Na+].[O-]B1OB2OB(O1)OB1OB(O2)O1 |
|---|