Introduction:Basic information about CAS 194979-70-9|(S)-CPP sodium salt, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (S)-CPP sodium salt |
|---|
| CAS Number | 194979-70-9 | Molecular Weight | 206.60 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C9H8ClNaO2 | Melting Point | / |
|---|
| MSDS | USA | Flash Point | / |
|---|
Names
Chemical & Physical Properties
| Molecular Formula | C9H8ClNaO2 |
|---|
| Molecular Weight | 206.60 |
|---|
| InChIKey | HMHPCHNNVOLTFC-QRPNPIFTSA-M |
|---|
| SMILES | O=C([O-])C(Cl)Cc1ccccc1.[Na+] |
|---|
Safety Information
| RIDADR | NONH for all modes of transport |
|---|