Introduction:Basic information about CAS 155196-97-7|2-Azidoethyl alpha-D-mannopyranoside, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Azidoethyl alpha-D-mannopyranoside |
|---|
| CAS Number | 155196-97-7 | Molecular Weight | 249.22 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C8H15N3O6 | Melting Point | / |
|---|
| MSDS | USA | Flash Point | / |
|---|
Names
| Name | 2-Azidoethyl alpha-D-mannopyranoside |
|---|
Chemical & Physical Properties
| Molecular Formula | C8H15N3O6 |
|---|
| Molecular Weight | 249.22 |
|---|
| InChIKey | VGCOVRUENPCVTD-HEIBUPTGSA-N |
|---|
| SMILES | [N-]=[N+]=NCCOC1OC(CO)C(O)C(O)C1O |
|---|
Safety Information
| RIDADR | NONH for all modes of transport |
|---|