Introduction:Basic information about CAS 8015-26-7|(Acetato-O)phenylmercury mixt. with chloroethylmercury, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (Acetato-O)phenylmercury mixt. with chloroethylmercury |
|---|
| CAS Number | 8015-26-7 | Molecular Weight | 600.84 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C10H12ClHg2O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | (Acetato-O)phenylmercury mixt. with chloroethylmercury |
|---|
Chemical & Physical Properties
| Molecular Formula | C10H12ClHg2O2 |
|---|
| Molecular Weight | 600.84 |
|---|
| InChIKey | AORJQWZRQSSSRO-UHFFFAOYSA-M |
|---|
| SMILES | CC(=O)O[Hg]c1ccccc1.ClCC[Hg] |
|---|