Introduction:Basic information about CAS 1173167-13-9|(1R)-2-(4-methylphenyl)-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (1R)-2-(4-methylphenyl)-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethanamine;hydrochloride |
|---|
| CAS Number | 1173167-13-9 | Molecular Weight | 349.7 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C19H29BClNO2 | Melting Point | / |
|---|
| MSDS | USA | Flash Point | / |
|---|
Names
| Name | (1R)-2-(4-methylphenyl)-1-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]ethanamine;hydrochloride |
|---|
Chemical & Physical Properties
| Molecular Formula | C19H29BClNO2 |
|---|
| Molecular Weight | 349.7 |
|---|
| InChIKey | VQNKQUSRBOELKD-KTZYUNSISA-N |
|---|
| SMILES | Cc1ccc(CC(N)B2OC3CC4CC(C4(C)C)C3(C)O2)cc1.Cl |
|---|
Safety Information
| RIDADR | NONH for all modes of transport |
|---|