Introduction：Basic information about (1-Hydroxyethylidene)bis-phosphonic acid tetrasodium salt CAS 3794-83-0, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
(1-Hydroxyethylidene)bis-phosphonic acid tetrasodium salt Basic information
| Product Name: | (1-Hydroxyethylidene)bis-phosphonic acid tetrasodium salt |
| Synonyms: | Sodium Salt of 1-Hydroxyethylene -1, 1,-Diphosphonic Acid HEDP.4Na;1-Hydroxyethylidene-1,1-diphosphonicacid,tetrasodiumsalt;deflocen43;dequest2016;ethane-1-hydroxy-1,1-diphosphonicacid,tetrasodiumsalt;Phosphonicacid,(1-hydroxyethylidene)bis-,tetrasodiumsalt;tetrasodium 1-hydroxyethylidene diphosphonate;tetra sodium hydroxyethylidene diphosphonate |
| CAS: | 3794-83-0 |
| MF: | C2H9NaO7P2 |
| MW: | 230.02 |
| EINECS: | 223-267-7 |
| Product Categories: | Phosphonate antiscalant |
| Mol File: | 3794-83-0.mol |
|
(1-Hydroxyethylidene)bis-phosphonic acid tetrasodium salt Chemical Properties
| density | 2.074[at 20℃] |
| vapor pressure | 0Pa at 25℃ |
| solubility | Aqueous Acid (Slightly), Water (Sparingly) |
| pka | 2.18[at 20 ℃] |
| form | Solid |
| color | White to Off-White |
| Water Solubility | 774g/L at 20℃ |
| Stability: | Hygroscopic |
| Cosmetics Ingredients Functions | CHELATING
EMULSION STABILISING
VISCOSITY CONTROLLING |
| InChI | InChI=1S/C2H8O7P2.Na.H/c1-2(3,10(4,5)6)11(7,8)9;;/h3H,1H3,(H2,4,5,6)(H2,7,8,9);; |
| InChIKey | MFKOTRZLMIUIGE-UHFFFAOYSA-N |
| SMILES | C(O)(C)(P(O)(O)=O)P(O)(O)=O.[NaH] |
| LogP | -3 at 23℃ |
| CAS DataBase Reference | 3794-83-0(CAS DataBase Reference) |
| EPA Substance Registry System | Phosphonic acid, (1-hydroxyethylidene)bis-, tetrasodium salt (3794-83-0) |
Safety Information
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/38-36-22 |
| Safety Statements | 26-36/37/39-36 |
| RTECS | JL6475000 |
| TSCA | TSCA listed |
| Toxicity | rat,LD50,oral,990mg/kg (990mg/kg),KIDNEY, URETER, AND BLADDER: CHANGES IN BOTH TUBULES AND GLOMERULI,Toxicology and Applied Pharmacology. Vol. 22, Pg. 661, 1972. |
(1-Hydroxyethylidene)bis-phosphonic acid tetrasodium salt Usage And Synthesis
| Uses | (1-Hydroxyethylidene)bis-phosphonic Acid Tetrasodium Salt is used in method for applying a gel compound on a surface of a device and corresponding coated device. |
| Flammability and Explosibility | Not classified |
(1-Hydroxyethylidene)bis-phosphonic acid tetrasodium salt Preparation Products And Raw materials
| Raw materials | Etidronic Acid |
