Introduction：Basic information about (1R,2R)-2-methoxycyclobutan-1-amine hydrochloride CAS 1820576-22-4, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
(1R,2R)-2-methoxycyclobutan-1-amine hydrochloride Basic information
| Product Name: | (1R,2R)-2-methoxycyclobutan-1-amine hydrochloride |
| Synonyms: | (1R,2R)-2-methoxycyclobutan-1-amine hydrochloride;Cyclobutanamine, 2-methoxy-, hydrochloride (1:1), (1R,2R)-;(1R, 2R)-2-Methoxy-cyclobutylamine hydrochloride;(1R,2R)-2-methoxycyclobutanamine;(1R,2R)-2-Methoxycyclobutanamine Hydrochloride |
| CAS: | 1820576-22-4 |
| MF: | C5H12ClNO |
| MW: | 137.60788 |
| EINECS: | 000-000-0 |
| Product Categories: | |
| Mol File: | 1820576-22-4.mol |
|
(1R,2R)-2-methoxycyclobutan-1-amine hydrochloride Chemical Properties
| storage temp. | Store at Room Tem. |
| Appearance | white powder |
| InChI | InChI=1/C5H11NO.ClH/c1-7-5-3-2-4(5)6;/h4-5H,2-3,6H2,1H3;1H/t4-,5-;/s3 |
| InChIKey | ZVONGBUZWDPLLF-TXRIQCMBNA-N |
| SMILES | O([C@@H]1CC[C@H]1N)C.Cl |&1:1,4,r| |
Safety Information
(1R,2R)-2-methoxycyclobutan-1-amine hydrochloride Usage And Synthesis
(1R,2R)-2-methoxycyclobutan-1-amine hydrochloride Preparation Products And Raw materials
