(1S)-(-)-alpha-Pinene CAS 7785-26-4
Introduction：Basic information about (1S)-(-)-alpha-Pinene CAS 7785-26-4, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
(1S)-(-)-alpha-Pinene Basic information
| Product Name: | (1S)-(-)-alpha-Pinene |
| Synonyms: | (1S,5S)-4,6,6-trimethylbicyclo[3.1.1]hept-3-ene;(1S)-2,6,6-trimethylbicyclo[3.1.1]-2-heptene;(1S)-(-)-A-PINENE FOR SYNTHESIS;(1S)-(-)-alpha-Pinene, 98% 250ML;(1S)-(-)-alpha-Pinene, 98% 500ML;(1s)-2,6,6-trimethylbicyclo[3.1.1]hept-2-ene;(1S)-(-)-a-pinene;(1S)-(-)-pin-2-ene |
| CAS: | 7785-26-4 |
| MF: | C10H16 |
| MW: | 136.23 |
| EINECS: | 232-077-3 |
| Product Categories: | Industrial/Fine Chemicals;Bicyclic Monoterpenes;Biochemistry;Terpenes;API intermediates |
| Mol File: | 7785-26-4.mol |
(1S)-(-)-alpha-Pinene Chemical Properties
| Melting point | -64 °C(lit.) |
| Boiling point | 156-158 °C(lit.) |
| alpha | -41.5 º (c=neat) |
| density | 0.874 g/mL at 25 °C |
| vapor density | 4.7 (vs air) |
| vapor pressure | ~3 mm Hg ( 20 °C) |
| refractive index | n |
| FEMA | 2902 | ALPHA-PINENE |
| Fp | 90 °F |
| storage temp. | Store at +2°C to +8°C. |
| solubility | Chloroform (Sparingly), Methanol (Slightly) |
| form | Liquid |
| color | Clear colorless |
| Odor | at 10.00 % in dipropylene glycol. sharp warm resinous fresh pine |
| Odor Type | herbal |
| biological source | Pinus spp. |
| Optical Rotation | [α]22/D 42°, neat |
| explosive limit | 0.8%(V) |
| Water Solubility | INSOLUBLE |
| Merck | 14,7445 |
| JECFA Number | 1329 |
| BRN | 1903790 |
| Major Application | flavors and fragrances |
| Cosmetics Ingredients Functions | PERFUMING |
| InChI | 1S/C10H16/c1-7-4-5-8-6-9(7)10(8,2)3/h4,8-9H,5-6H2,1-3H3/t8-,9-/m0/s1 |
| InChIKey | GRWFGVWFFZKLTI-UHFFFAOYSA-N |
| SMILES | [C@@H]21C([C@@H](C2)C(=CC1)C)(C)C |
| LogP | 4.48 at 37℃ |
| CAS DataBase Reference | 7785-26-4(CAS DataBase Reference) |
| NIST Chemistry Reference | (1s)-2,6,6-Trimethylbicyclo[3.1.1]hept-2-ene(7785-26-4) |
| EPA Substance Registry System | 2-Pinene, (1S,5S)-(-)- (7785-26-4) |
Safety Information
| Hazard Codes | Xn,N,Xi |
| Risk Statements | 10-36/37/38-43-50-65-51/53-20/21/22 |
| Safety Statements | 26-36/37-61-16-60 |
| RIDADR | UN 2368 3/PG 3 |
| WGK Germany | 1 |
| RTECS | DT 7000000 |
| F | 10 |
| Autoignition Temperature | 491 °F |
| TSCA | TSCA listed |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29021910 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 2 Asp. Tox. 1 Flam. Liq. 3 Skin Irrit. 2 |
| Chemical Properties | (1S)-(-)-alpha-Pinene is clear colourless liquid |
| Uses | (1S)-(-)-alpha-Pinene is used in the preparation of hydroxy ketones such as hydroxycarvones. |
| Uses | (1S)-(-)-α-Pinene is used in the preparation of hydroxy ketones such as hydroxycarvones. |
| Definition | ChEBI: (-)-alpha-pinene is an alpha-pinene. It is an enantiomer of a (+)-alpha-pinene. |
| General Description | α-Pinene is a monoterpene used in industries like fragrance, pharmaceuticals, flavor, and cosmetics. It is a major component of pine oil and turpentine oil. Isomerization of α-pinene yields industrially important compounds like camphene, limonene, and p-cymene. |
| reaction suitability | reagent type: reductant |
| Purification Methods | Purify as for 1R,5S--Pinene above. [Beilstein 5 III 366, 5 IV 455.] |
(1S)-(-)-alpha-Pinene Preparation Products And Raw materials
| Raw materials | alpha-Pinene |
| Preparation Products | 2,6-DIMETHYL-2,4,6-OCTATRIENE-->6,6-dimethyl-2-methylidene-norpinan-3-one-->(1S,2S,5S)-(-)-2-Hydroxy-3-pinanone-->(1R,2R,3S,5R)-(-)-2,3-Pinanediol-->Bicyclo[3.1.1]heptane-2,3-diol, 2,6,6-trimethyl-, [1R-(1α,2β,3β,5α)]- (9CI)-->(+)-(1R,2R,5R)--Ethyl [(2-Hydroxypinan-3-ylene)aMino]acetate |
