Introduction:Basic information about (4S,5R)-(-)-4-METHYL-5-PHENYL-2-OXAZOLIDINONE CAS 16251-45-9, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
(4S,5R)-(-)-4-METHYL-5-PHENYL-2-OXAZOLIDINONE Basic information
| Product Name: | (4S,5R)-(-)-4-METHYL-5-PHENYL-2-OXAZOLIDINONE |
| Synonyms: | (4S,5R)-(-)-4-METHYL-5-PHENYL-2-OXAZOLIDINONE;(4S,5R)-4-METHYL-5-PHENYL-2-OXAZOLIDINONE;(4S,5R)-(-)-4-METHYL-5-PHENYLOXAZOLIDIN-2-ONE;(4S,5R)-(-)-4-METHYL-5-PHENYL-2-OXAZOLID -INONE, 99% (99% EE/HPLC);2-Oxazolidinone, 4-methyl-5-phenyl-, (4S,5R)-;(4S,5R)-(-)-4-METHYL-5-PHENYLOXAZOLIDIN-2-ONE 99+%;(4S,5R)-(-)-4-Methyl-5-phenyl-2-oxazolidinone,99%;(4S,5R)-(-)-4-Methyl-2-oxo-5-phenyl-1,3-oxazolidine |
| CAS: | 16251-45-9 |
| MF: | C10H11NO2 |
| MW: | 177.2 |
| EINECS: | 202-303-5 |
| Product Categories: | Peptide;Asymmetric Synthesis;Chiral Auxiliaries;Oxazolidinone Derivatives;API intermediates |
| Mol File: | 16251-45-9.mol |
|
(4S,5R)-(-)-4-METHYL-5-PHENYL-2-OXAZOLIDINONE Chemical Properties
| Melting point | 121-123 °C(lit.) |
| Boiling point | 309.12°C (rough estimate) |
| density | 1.1607 (rough estimate) |
| refractive index | 1.5168 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 12.35±0.60(Predicted) |
| form | solid |
| color | Off-white |
| Optical Rotation | [α]25/D 168°, c = 2 in chloroform |
| InChI | InChI=1S/C10H11NO2/c1-7-9(13-10(12)11-7)8-5-3-2-4-6-8/h2-7,9H,1H3,(H,11,12)/t7-,9-/m0/s1 |
| InChIKey | PPIBJOQGAJBQDF-CBAPKCEASA-N |
| SMILES | O1[C@H](C2=CC=CC=C2)[C@H](C)NC1=O |
| CAS DataBase Reference | 16251-45-9(CAS DataBase Reference) |
Safety Information
| Safety Statements | 24/25-25-24 |
| WGK Germany | 3 |
| HS Code | 29269090 |
| Storage Class | 11 - Combustible Solids |
(4S,5R)-(-)-4-METHYL-5-PHENYL-2-OXAZOLIDINONE Usage And Synthesis
| Chemical Properties | white crystals |
| Uses | (4S,5R)-(-)-4-Methyl-5-phenyl-2-oxazolidinone may be used to synthesize (4S,5R)-N-tert-butyloxycarbonyl)-4-methyl-5-carboxy-2-oxazolidinone and (+)-pumiliotoxin B. |
(4S,5R)-(-)-4-METHYL-5-PHENYL-2-OXAZOLIDINONE Preparation Products And Raw materials