Introduction：Basic information about (R)-(-)-4-Phenyl-2-oxazolidinone CAS 90319-52-1, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
(R)-(-)-4-Phenyl-2-oxazolidinone Basic information
| Product Name: | (R)-(-)-4-Phenyl-2-oxazolidinone |
| Synonyms: | (4R)-4-PHENYLOXAZOLIDIN-2-ONE;(4R)-4-PHENYL-1,3-OXAZOLIDIN-2-ONE;(4R)-PHENYL-2-OXAZOLIDINONE;(R)-(-)-4-PHENYL-2-OXAZOLIDINONE;(R)-(+)-4-PHENYL-2-OXAZOLIDINONE;(R)-4-PHENYL-2-OXAZOLIDINONE;S/R-4-BENZYL-2-OXAZOLIDINONE;(R)-PH-OXAZOLIDINONE |
| CAS: | 90319-52-1 |
| MF: | C9H9NO2 |
| MW: | 163.17 |
| EINECS: | 618-527-5 |
| Product Categories: | Peptide;Aromatics;Heterocycles;Asymmetric Synthesis;Chiral Auxiliaries;Oxazolidinone Derivatives;Chiral Reagent;Aromatics Compounds;Asymmetric Synthesis;Chiral Building Blocks;Glycidyl Compounds, etc. (Chiral);Synthetic Organic Chemistry;Chiral chemicals;chiral;Oxazolidinone;Isoxazoles, Oxadiazoles, Oxazoles;bc0001 |
| Mol File: | 90319-52-1.mol |
|
(R)-(-)-4-Phenyl-2-oxazolidinone Chemical Properties
| Melting point | 131-133 °C(lit.) |
| alpha | -49.5 º (c=2, CHCl3) |
| Boiling point | 290.25°C (rough estimate) |
| density | 1.2021 (rough estimate) |
| refractive index | -72 ° (C=1, AcOEt) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Chloroform (Slightly), Ethyl Acetate, Methanol (Slightly) |
| pka | 12.05±0.40(Predicted) |
| form | Solid |
| color | White to Off-White |
| Optical Rotation | [α]25/D 48°, c = 2 in chloroform |
| BRN | 4308995 |
| InChI | InChI=1S/C9H9NO2/c11-9-10-8(6-12-9)7-4-2-1-3-5-7/h1-5,8H,6H2,(H,10,11)/t8-/m0/s1 |
| InChIKey | QDMNNMIOWVJVLY-QMMMGPOBSA-N |
| SMILES | O1C[C@@H](C2=CC=CC=C2)NC1=O |
| CAS DataBase Reference | 90319-52-1(CAS DataBase Reference) |
Safety Information
| Hazard Codes | F+,Xi |
| Risk Statements | 12-36 |
| Safety Statements | 22-24/25-33-26-16-7/9 |
| WGK Germany | 3 |
| F | 3-10 |
| HS Code | 29349990 |
| Storage Class | 11 - Combustible Solids |
(R)-(-)-4-Phenyl-2-oxazolidinone Usage And Synthesis
| Chemical Properties | white to light yellow crystal powde |
| Uses | synthon for a-amino acids and b-lactam antibiotics |
| Uses | (R)-(-)-4-Phenyl-2-oxazolidinone (cas# 90319-52-1) is a compound useful in organic synthesis. |
| Uses | Used for α-amino acid synthesis and the preparation of β-lactam antibiotics. |
(R)-(-)-4-Phenyl-2-oxazolidinone Preparation Products And Raw materials
| Raw materials | Benzeneacetic acid, -alpha-,4-dimethyl-, (-alpha-S)- (9CI)-->2-Oxazolidinone, 3-(2-bromo-1-oxopropyl)-4-phenyl-, (4R)--->4-Phenyl-4-oxazolin-2-one-->(R)-4-PHENYL-3-PROPIONYL-2-OXAZOLIDINONE-->(S)-(+)-4-Phenyl-2-oxazolidinone-->D-Phenylglycinol-->D-2-Phenylglycine |
| Preparation Products | (2S)-2-(4-Chlorophenyl)propanoic acid-->(2R,3R)-3-(3-(Benzyloxy)phenyl-2-methylpentanoic acid-->(S)-(+)-2-PHENYLBUTYRIC ACID-->(αR,βR)-β-ethyl-3-methoxy-α-methylbenzenepropanoic acid-->(αS)-α-Isopropylbenzeneacetic acid-->(S)-(+)-2-Phenylpropionic acid-->Naproxen-->(4R)-3-(2-Bromoacetyl)-4-phenyl-1,3-oxazolidin-2-one-->[R-(E)]-3-(1-Oxo-2-pentenyl)-4-phenyl-2-oxazolidinone |
