(R)-2,2',3,3'-TETRAHYDRO-1,1'-SPIROBI[INDENE]-7,7'-DIOL, >=95% CAS 223259-62-
Introduction:Basic information about (R)-2,2',3,3'-TETRAHYDRO-1,1'-SPIROBI[INDENE]-7,7'-DIOL, >=95% CAS 223259-62-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
(R)-2,2',3,3'-TETRAHYDRO-1,1'-SPIROBI[INDENE]-7,7'-DIOL, >=95% Basic information
| Product Name: | (R)-2,2',3,3'-TETRAHYDRO-1,1'-SPIROBI[INDENE]-7,7'-DIOL, >=95% |
| Synonyms: | (R)-2,2',3,3'-Tetrahydro-1,1'-spirobi[1H-indene]-7,7'-diol, 99%e.e.;(R)-2,2',3,3'-TETRAHYDRO-1,1'-SPIROBI[INDENE]-7,7'-DIOL, >=95%;(Ra)-1,1'-spirobiindane-7,7'-diol;R-2,2',3,3'-Tetrahydro-1,1'-spirobi[1H-indene]-7,7'-diol;R-2,2',3,3'-tetrahydro-1,1'-spirobi[indene]-7,7'-diol;(1R)-2,2',3,3'-tetrahydro-1,1'-Spirobi[1H-indene]-7,7'-diol;1,1'-Spirobi[1H-indene]-7,7'-diol, 2,2',3,3'-tetrahydro-, (1R)-;(R)-2,2',3,3'-TETRAHYDRO-1,1'-SPIROBI[INDENE]-7,7'-DIOL,99% |
| CAS: | 223259-62-9 |
| MF: | C17H16O2 |
| MW: | 252.31 |
| EINECS: | |
| Product Categories: | BINOL Series;Chiral Oxygen;Chiral Spiro Ligand |
| Mol File: | 223259-62-9.mol |
| =95% Structure" src="CAS/20150408/GIF/223259-62-9.gif"/> | |
(R)-2,2',3,3'-TETRAHYDRO-1,1'-SPIROBI[INDENE]-7,7'-DIOL, >=95% Chemical Properties
| Melting point | 156.0 to 160.0 °C |
| Boiling point | 433.0±45.0 °C(Predicted) |
| density | 1.34±0.1 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | solid |
| pka | 9.70±0.20(Predicted) |
| color | white |
| InChI | InChI=1S/C17H16O2/c18-13-5-1-3-11-7-9-17(15(11)13)10-8-12-4-2-6-14(19)16(12)17/h1-6,18-19H,7-10H2 |
| InChIKey | YBRDFCQKQVTQKX-UHFFFAOYSA-N |
| SMILES | [C@@]12(C3=C(C=CC=C3O)CC1)C1=C(C=CC=C1O)CC2 |
Safety Information
| HS Code | 2907.29.9000 |
| Uses | (R)-SPINOL is used in the synthesis of (R,R)-f-SpiroPhos (S683030). |
