Introduction：Basic information about (S)-2-Benzylsuccinic acid CAS 3972-36-9, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
(S)-2-Benzylsuccinic acid Basic information
| Product Name: | (S)-2-Benzylsuccinic acid |
| Synonyms: | (S)-2-BENZYLSUCCINIC ACID;(S)-2-BENZYL-1,4-BUTANEDIOIC ACID;Mitiglinide intermediate 2;Mitiglinide intermediate 8;(S)-2-Benzylsuccinic acid (Mitiglinide);(S)-2-Benzylsuccinic (2S)-2-benzylbutanedioic acid;Butanedioicacid, 2-(phenylmethyl)-, (2S)- |
| CAS: | 3972-36-9 |
| MF: | C11H12O4 |
| MW: | 208.21 |
| EINECS: | 609-742-5 |
| Product Categories: | APIs Intermediate;Pharmaceutical material and intermeidates;Acids and Derivatives |
| Mol File: | 3972-36-9.mol |
|
(S)-2-Benzylsuccinic acid Chemical Properties
| Melting point | 164.0 to 168.0 °C |
| Boiling point | 331.4±22.0 °C(Predicted) |
| density | 1.290±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 3.97±0.10(Predicted) |
| color | White to Almost white |
| InChI | InChI=1S/C11H12O4/c12-10(13)7-9(11(14)15)6-8-4-2-1-3-5-8/h1-5,9H,6-7H2,(H,12,13)(H,14,15)/t9-/m0/s1 |
| InChIKey | GTOFKXZQQDSVFH-VIFPVBQESA-N |
| SMILES | C(O)(=O)[C@@H](CC1=CC=CC=C1)CC(O)=O |
| CAS DataBase Reference | 3972-36-9(CAS DataBase Reference) |
Safety Information
(S)-2-Benzylsuccinic acid Usage And Synthesis
| Description | (S)-2-Benzylsuccinic acid is a widely used compound, which was employed as a key intermediate for hypoglycemic KAD-1229 by means of asymmetric alkylation of N-acylsulta. It can be synthesized by various procedures. The preparation of (S)-2-benzylsuccinic acid from L-phenylalanine is considered to be one of the most clean, efficient and convenient processes. The compound is a common chiral synthesis intermediate. |
| Uses | (S)-2-Benzylsuccinic acid is a common asymmetric synthesis intermediate in which the carboxyl group in the structure can be converted to common active functional groups, such as hydroxyl groups under the reduction of boranes. In addition, the two carboxyl groups in the structure can be heated and dehydrated and condensed in the presence of acetic anhydride or acetyl chloride to obtain the corresponding anhydride structure. |
(S)-2-Benzylsuccinic acid Preparation Products And Raw materials
| Raw materials | 2-benzylidenesuccinic acid-->(R)-2-Benzylsuccinic acid |
| Preparation Products | [2(S)-cis]-Octahydro-gamma-oxo-alpha-(phenylmethyl)-2H-isoindole-2-butanoic acid |
