[3-(Dimethylamino)propyl]triphenylphosphonium bromide hydrobromide CAS 27710-82-3
Introduction：Basic information about [3-(Dimethylamino)propyl]triphenylphosphonium bromide hydrobromide CAS 27710-82-3, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
[3-(Dimethylamino)propyl]triphenylphosphonium bromide hydrobromide Basic information
| Product Name: | [3-(Dimethylamino)propyl]triphenylphosphonium bromide hydrobromide |
| Synonyms: | (3-DIMETHYLAMINOPROPYL)TRIPHENYLPHOSPHONIUM BROMIDE HYDROBROMIDE 98%;(3-DIMETHYLAMINOPROPYL)TRIPHENYLPHOSPHONIUM BROMIDE HBR;(3-DIMETHYLAMINOPROPYL)TRIPHENYLPHOSPHONIUM BROMIDE HYDROBROMIDE;[3-(Dimethylamino)pr;[3-(DiMethylaMino)propyl]triphenylphosphoniuM broM;triphenylphosphoniuM broMide hydrobroMide;(3-(DiMethylaMino)propyl)triphenylphosphoniuM broMide hydrobroMidepuruM;(3-diMethylaMinopropyl)triphenylphospho-niuM broMo hydrobroMide |
| CAS: | 27710-82-3 |
| MF: | C23H28Br2NP |
| MW: | 509.27 |
| EINECS: | 608-135-2 |
| Product Categories: | APIs Intermediate |
| Mol File: | 27710-82-3.mol |
[3-(Dimethylamino)propyl]triphenylphosphonium bromide hydrobromide Chemical Properties
| Melting point | 283-285 °C |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| color | Off-White |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C23H27NP.2BrH/c1-24(2)19-12-20-25(21-13-6-3-7-14-21,22-15-8-4-9-16-22)23-17-10-5-11-18-23;;/h3-11,13-18H,12,19-20H2,1-2H3;2*1H/q+1;;/p-1 |
| InChIKey | NEQVFHFOWYYPBS-UHFFFAOYSA-M |
| SMILES | [P+](C1C=CC=CC=1)(C1C=CC=CC=1)(C1C=CC=CC=1)CCCN(C)C.[Br-].Br |
| CAS DataBase Reference | 27710-82-3(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 3-10 |
| Uses | (3-(Dimethylamino)propyl)triphenylphosphonium bromide is used as a reactant for preparing chlorpheniramine analogs reverse chloroquine resistance in Plasmodium falciparum by inhibiting PfCRT. |
| Synthesis | 3607-17-8 124-40-3 27710-82-3 To a suspension of (3-bromopropyl)triphenylphosphonium bromide (1.0 g, 2.1 mmol) in ethanol (5 mL) was slowly added 40% aqueous dimethylamine (3 mL) at room temperature. The reaction mixture was transferred to a sealed microwave reaction tube and heated at 100 °C with stirring for 30 min. Upon completion of the reaction, the solvent was removed by distillation under reduced pressure to give the crude product. The crude product was purified by recrystallization in acetonitrile to afford [3-(dimethylamino)propyl]triphenylphosphonium bromide hydrobromide (0.90 g, 82% yield) as a white solid, which was used directly in the subsequent reaction.ESI MS m/z 348.3 (corresponding to Ph3PCH2CH2CH2CH2NMe2+ ions). |
| References | [1] Patent: WO2012/79017, 2012, A1. Location in patent: Page/Page column 68 [2] Patent: US2007/232814, 2007, A1. Location in patent: Page/Page column 24 |
[3-(Dimethylamino)propyl]triphenylphosphonium bromide hydrobromide Preparation Products And Raw materials
| Raw materials | (3-BROMOPROPYL)TRIPHENYLPHOSPHONIUM BROMIDE-->Dimethylamine |
| Preparation Products | Olopatadine-->Olopatadine hydrochloride-->(E)-Olopatadine Hydrochloride |
