Introduction：Basic information about 1-(2,6-Dichlorophenyl)-2-hydroindole CAS 15362-40-0, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
1-(2,6-Dichlorophenyl)-2-hydroindole Basic information
| Product Name: | 1-(2,6-Dichlorophenyl)-2-hydroindole |
| Synonyms: | Diclofenac PotassiumⅠ:1-(2,6-Dichlorophenyl)-1,3-dihydro-2H-indol-2-one;Diclofenac Sodium ImpurityⅠ: 1-(2,6-Dichlorophenyl)-1,3-dihydro-2H-indol-2-one;Indolinone (Diclofenac Amide, Diclofenac Lactam);DICLOFENAC RELATED COMPOUND A (50 MG) (N-(2,6-DICHLOROPHENYL)INDOLIN-2-ONE);1-(2,6-Dichlorophenyl)-2,3-dihydro-1H-indole-2-one;Diclofenac Amide;6-Dichlorophenyl)-2-indolinone;N-(2,6-Dichlorophenyl)-Indolin-(2)-One |
| CAS: | 15362-40-0 |
| MF: | C14H9Cl2NO |
| MW: | 278.13 |
| EINECS: | 239-399-3 |
| Product Categories: | Aromatics, Heterocycles, Impurities, Pharmaceuticals, Intermediates & Fine Chemicals;Aromatics;Heterocycles;Impurities;Intermediates & Fine Chemicals;Pharmaceuticals |
| Mol File: | 15362-40-0.mol |
|
1-(2,6-Dichlorophenyl)-2-hydroindole Chemical Properties
| Melting point | 115-119°C |
| Boiling point | 488.6±45.0 °C(Predicted) |
| density | 1.432±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| pka | -4.85±0.20(Predicted) |
| form | solid |
| color | Off-White to Light Brown |
| BRN | 1538309 |
| Stability: | Stability |
| InChI | 1S/C14H9Cl2NO/c15-10-5-3-6-11(16)14(10)17-12-7-2-1-4-9(12)8-13(17)18/h1-7H,8H2 |
| InChIKey | JCICIFOYVSPMHG-UHFFFAOYSA-N |
| SMILES | Clc1cccc(Cl)c1N2C(=O)Cc3ccccc23 |
| CAS DataBase Reference | 15362-40-0(CAS DataBase Reference) |
Safety Information
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| RTECS | NM3259200 |
| HS Code | 29337900 |
| Storage Class | 11 - Combustible Solids |
| Toxicity | mouse,LD50,unreported,1200mg/kg (1200mg/kg),Pharmaceutical Chemistry Journal Vol. 21, Pg. 275, 1987. |
1-(2,6-Dichlorophenyl)-2-hydroindole Usage And Synthesis
| Chemical Properties | Off-White to Light Brown Solid |
| Uses | 1-(2,6-Dichlorophenyl)indolin-2-one is a potential prodrug of Diclofenac and possible impurity during its commercial synthesis. It is Aceclofenac EP Impurity I and Diclofenac Impurity A. |
1-(2,6-Dichlorophenyl)-2-hydroindole Preparation Products And Raw materials
| Raw materials | DICLOFENAC METHYL ESTER-->2-(2,6-Dichloroanilino) benzaldehyde-->1-(2,6-Dichlorophenyl)indole-2,3-dione-->Diclofenac sodium-->Methanol |
| Preparation Products | Oxindole |
