Introduction：Basic information about 1-(5-Hydroxypyrazin-2-yl)ethanone CAS 1159813-33-8, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
1-(5-Hydroxypyrazin-2-yl)ethanone Basic information
| Product Name: | 1-(5-Hydroxypyrazin-2-yl)ethanone |
| Synonyms: | 1-(5-Hydroxypyrazin-2-yl)ethanone;2(1H)-Pyrazinone, 5-acetyl- |
| CAS: | 1159813-33-8 |
| MF: | C6H6N2O2 |
| MW: | 138.12 |
| EINECS: | |
| Product Categories: | |
| Mol File: | 1159813-33-8.mol |
|
1-(5-Hydroxypyrazin-2-yl)ethanone Chemical Properties
| density | 1.33±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| pka | 10.62±0.40(Predicted) |
| InChI | InChI=1S/C6H6N2O2/c1-4(9)5-2-8-6(10)3-7-5/h2-3H,1H3,(H,8,10) |
| InChIKey | QKRGMTSGTKSZHX-UHFFFAOYSA-N |
| SMILES | C1(=O)NC=C(C(C)=O)N=C1 |
Safety Information
1-(5-Hydroxypyrazin-2-yl)ethanone Usage And Synthesis
1-(5-Hydroxypyrazin-2-yl)ethanone Preparation Products And Raw materials
