Introduction：Basic information about 1-(Difluoromethyl)-4-nitrobenzene CAS 29848-57-5, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
1-(Difluoromethyl)-4-nitrobenzene Basic information
| Product Name: | 1-(Difluoromethyl)-4-nitrobenzene |
| Synonyms: | 1-(Difluoromethyl)-4-nitrobenzene;4-Difluoromethyl-1-nitrobenzene;p-Nitrobenzal difluoride;4-(difluoromethyl)nitrobenzene;4-Nitrobenzal fluoride;Benzene, 1-(difluoromethyl)-4-nitro- |
| CAS: | 29848-57-5 |
| MF: | C7H5F2NO2 |
| MW: | 173.12 |
| EINECS: | |
| Product Categories: | |
| Mol File: | 29848-57-5.mol |
|
1-(Difluoromethyl)-4-nitrobenzene Chemical Properties
| Boiling point | 241℃ |
| density | 1.339 |
| refractive index | 1.5075 |
| Fp | 112℃ |
| storage temp. | 2-8°C |
| form | liquid |
| color | clear |
| InChI | 1S/C7H5F2NO2/c8-7(9)5-1-3-6(4-2-5)10(11)12/h1-4,7H |
| InChIKey | RMHPWPAKPAVHTB-UHFFFAOYSA-N |
| SMILES | FC(F)c1ccc(cc1)[N+](=O)[O-] |
Safety Information
| WGK Germany | WGK 3 |
| HazardClass | IRRITANT-HARMFUL |
| HS Code | 2916399090 |
| Storage Class | 11 - Combustible Solids |
1-(Difluoromethyl)-4-nitrobenzene Usage And Synthesis
| Uses | p-Nitrobenzal Difluoride is a reagent used in the preparation of fluorine-18-labeled fluoxetine as a potential radiotracer for reuptake sites. |
1-(Difluoromethyl)-4-nitrobenzene Preparation Products And Raw materials
