Introduction:Basic information about 1,3-Bis((3-methyl-2,5-dioxopyrrol-1-yl)methyl)benzol CAS 119462-56-5, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
1,3-Bis((3-methyl-2,5-dioxopyrrol-1-yl)methyl)benzol Basic information
| Product Name: | 1,3-Bis((3-methyl-2,5-dioxopyrrol-1-yl)methyl)benzol |
| Synonyms: | 1,3-bis(citraconimidomethyl)benzene;1,3-Bis(citraconimidomethyl)benzol;1,3-Bis((3-methyl-2,5-dioxopyrrol-1-yl)methyl)benzol;MIIBUHIQXLFJFP-UHFFFAOYSA-N;Anti-reversion agent;anti-vulcanization agent;Flexsys Perkalink 900 equivalent;PK900 |
| CAS: | 119462-56-5 |
| MF: | C18H16N2O4 |
| MW: | 324.33 |
| EINECS: | 412-570-1 |
| Product Categories: | Rubber & Plastic Auxiliary Agent |
| Mol File: | 119462-56-5.mol |
|
1,3-Bis((3-methyl-2,5-dioxopyrrol-1-yl)methyl)benzol Chemical Properties
| Boiling point | 533.1±43.0 °C(Predicted) |
| density | 1.378±0.06 g/cm3(Predicted) |
| vapor pressure | 0Pa at 25℃ |
| solubility | 10 in mg/100g standard fat at 20 ℃ |
| pka | -2.02±0.40(Predicted) |
| Water Solubility | 40.8mg/L at 20℃ |
| InChI | InChI=1S/C18H16N2O4/c1-11-6-15(21)19(17(11)23)9-13-4-3-5-14(8-13)10-20-16(22)7-12(2)18(20)24/h3-8H,9-10H2,1-2H3 |
| InChIKey | MIIBUHIQXLFJFP-UHFFFAOYSA-N |
| SMILES | C1(CN2C(=O)C=C(C)C2=O)=CC=CC(CN2C(=O)C=C(C)C2=O)=C1 |
| LogP | 2.22 at 20℃ |
| EPA Substance Registry System | 1H-Pyrrole-2,5-dione, 1,1'-[1,3-phenylenebis(methylene)]bis[3-methyl- (119462-56-5) |
Safety Information
| Hazard Codes | Xn,N |
| Risk Statements | 41-43-48/22-50/53 |
| Safety Statements | 26-36/37/39-60-61 |
| RIDADR | 3077 |
| TSCA | TSCA listed |
| HazardClass | 9 |
| PackingGroup | III |
1,3-Bis((3-methyl-2,5-dioxopyrrol-1-yl)methyl)benzol Usage And Synthesis
| Chemical Properties | White powder |
| Flammability and Explosibility | Not classified |
1,3-Bis((3-methyl-2,5-dioxopyrrol-1-yl)methyl)benzol Preparation Products And Raw materials