Introduction:Basic information about 1,3-Diacetoxy-2-(acetoxymethoxy)propane CAS 86357-13-3, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
1,3-Diacetoxy-2-(acetoxymethoxy)propane Basic information
| Product Name: | 1,3-Diacetoxy-2-(acetoxymethoxy)propane |
| Synonyms: | 2-ACETOXYMETHOXY-1,3-DIACETOXY PROPANE;2-ACETOXYMETHOXY-1,3-PROPANEDIOL DIACETATE;acetic acid 1,3-dihydroxypropan-2-yloxymethyl ester;Triacetyl Methoxyglycerin;2-ACETOXYMETHOXY-1,3-PROPANEDIOL DIACEETATE;2-ACETOXYMETHOXY-1,3-DIACETOXYPROPANETRIACETYLMETHOXYGLYCERIN;1,3-Diacetoxy-2-(acetoxymethoxy)propane;2-[(Acetyloxy)methoxy]-1,3-propanediol diacetate |
| CAS: | 86357-13-3 |
| MF: | C10H16O7 |
| MW: | 248.23 |
| EINECS: | 617-837-8 |
| Product Categories: | heterocyclic/Aliphatic series;86357-13-3 |
| Mol File: | 86357-13-3.mol |
|
1,3-Diacetoxy-2-(acetoxymethoxy)propane Chemical Properties
| Boiling point | 311°C |
| density | 1.177 |
| Fp | 134°C |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform, Methanol |
| form | Oil |
| color | Clear Colourless to Light Yellow |
| InChI | InChI=1S/C10H16O7/c1-7(11)14-4-10(5-15-8(2)12)17-6-16-9(3)13/h10H,4-6H2,1-3H3 |
| InChIKey | DUOPMEBLLUYTNT-UHFFFAOYSA-N |
| SMILES | C(OC(=O)C)C(OCOC(C)=O)COC(=O)C |
| CAS DataBase Reference | 86357-13-3(CAS DataBase Reference) |
Safety Information
1,3-Diacetoxy-2-(acetoxymethoxy)propane Usage And Synthesis
| Uses | 1,3-Diacetoxy-2-(acetoxymethoxy)propane is a compound involved in the synthesis of Ganciclovir (G235000), an antiviral nucleoside analog structurally related to Acyclovir (A192400). |
1,3-Diacetoxy-2-(acetoxymethoxy)propane Preparation Products And Raw materials