Introduction：Basic information about 1,3-Diaminoguanidine monohydrochloride CAS 36062-19-8, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
1,3-Diaminoguanidine monohydrochloride Basic information
| Product Name: | 1,3-Diaminoguanidine monohydrochloride |
| Synonyms: | N,N'-Diaminoguandine;N,N'-Diaminoguanidine monohydrochloride, 98+%;N,N'-Diaminoguanidine monohydrochloride 98%;(E)-HYDRAZINECARBOHYDRAZONAMIDE HYDROCHLORIDE;1,3- twoaMinoguanidinehydrochloride;N,N'-DiaMinoguanidine hydrochloride SynonyMs 1,3-DiaMinoguanidine Monohydrochloride;DiaMinoguanidine Monohydrochlorid;DIAMINO GUANIDINA |
| CAS: | 36062-19-8 |
| MF: | CH8ClN5 |
| MW: | 125.56 |
| EINECS: | 252-854-0 |
| Product Categories: | Guanidines;Nitrogen Compounds;Amines;API intermediates;Organic Building Blocks |
| Mol File: | 36062-19-8.mol |
|
1,3-Diaminoguanidine monohydrochloride Chemical Properties
| Melting point | 180-182 °C (dec.)(lit.) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | water: soluble50mg/mL, clear to very slightly hazy, colorless to faintly yellow |
| form | Granular Powder |
| color | White to light beige |
| Water Solubility | very faint turbidity |
| Sensitive | Hygroscopic |
| BRN | 3556702 |
| InChI | InChI=1S/CH7N5.ClH/c2-1(5-3)6-4;/h3-4H2,(H3,2,5,6);1H |
| InChIKey | HAZRIBSLCUYMQP-UHFFFAOYSA-N |
| SMILES | C(=N)(NN)NN.Cl |
| CAS DataBase Reference | 36062-19-8(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 26-36-24/25 |
| WGK Germany | 3 |
| HS Code | 29212900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
1,3-Diaminoguanidine monohydrochloride Usage And Synthesis
| Chemical Properties | white to light beige granular powder |
| Uses | N,N''-Diaminoguanidine Monohydrochloride is an analyte for HPLC. It also functions as an intermediate for the synthesis of energetic salts or materials based on dinitroguanidine. |
| General Description | 1,3-Diaminoguanidine monohydrochloride undergoes condensation reaction with:
- 4-isothiocyanato-4-methylpentane-2-one to yield condensed pyrimidines
- various aldehydes and ketones to yield bis guanidine derivatives
|
1,3-Diaminoguanidine monohydrochloride Preparation Products And Raw materials
| Raw materials | Aminoguanidine hydrochloride-->Cyanogen chloride |
