Introduction:Basic information about 1,3-DIFLUORO-2-PROPANOL CAS 453-13-4, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
1,3-DIFLUORO-2-PROPANOL Basic information
| Product Name: | 1,3-DIFLUORO-2-PROPANOL |
| Synonyms: | 1,3-Difluoro-2-hydroxypropane;1,3-difluoro-2-propano;2-Propanol, 1,3-difluoro-;Geiftor;1,3-DIFLUOROPROPAN-2-OL;1,3-DIFLUORO-ISO-PROPANOL;1,3-DIFLUORO-2-PROPANOL;1,3-Difluoropropan-2-ol 97% |
| CAS: | 453-13-4 |
| MF: | C3H6F2O |
| MW: | 96.08 |
| EINECS: | 207-216-6 |
| Product Categories: | Alcohols;C2 to C6;Oxygen Compounds |
| Mol File: | 453-13-4.mol |
|
1,3-DIFLUORO-2-PROPANOL Chemical Properties
| Boiling point | 54-55 °C34 mm Hg(lit.) |
| density | 1.24 g/mL at 25 °C(lit.) |
| refractive index | n20/D 1.373(lit.) |
| Fp | 108 °F |
| storage temp. | Flammables area |
| solubility | soluble in DMSO, Methanol |
| pka | 12.67±0.20(Predicted) |
| form | Liquid |
| color | Clear yellow to brownish |
| BRN | 1732050 |
| InChI | InChI=1S/C3H6F2O/c4-1-3(6)2-5/h3,6H,1-2H2 |
| InChIKey | PVDLUGWWIOGCNH-UHFFFAOYSA-N |
| SMILES | C(F)C(O)CF |
| CAS DataBase Reference | 453-13-4(CAS DataBase Reference) |
| EPA Substance Registry System | 2-Propanol, 1,3-difluoro- (453-13-4) |
Safety Information
| Hazard Codes | Xi,F |
| Risk Statements | 10-36/37/38 |
| Safety Statements | 16-26-36 |
| RIDADR | UN 1987 3/PG 3 |
| WGK Germany | 3 |
| RTECS | UB1770000 |
| Hazard Note | Flammable |
| TSCA | TSCA listed |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29055998 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 |
1,3-DIFLUORO-2-PROPANOL Usage And Synthesis
| Chemical Properties | CLEAR COLOURLESS LIQUID |
| Uses | 1,3-Difluoro-2-propanol was used in the synthesis of 1,3-difluoroacetone. |
1,3-DIFLUORO-2-PROPANOL Preparation Products And Raw materials
| Raw materials | Hydrogen fluoride-->Epichlorohydrin-->Diethylene glycol-->Potassium hydrogen fluoride-->Gliftor |
| Preparation Products | 1,3-DIFLUOROACETONE-->Epifluorohydrin |