Introduction：Basic information about 1-Bromo-4-chloronaphthalene CAS 53220-82-9, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
1-Bromo-4-chloronaphthalene Basic information
| Product Name: | 1-Bromo-4-chloronaphthalene |
| Synonyms: | 1-Bromo-4-chloronaphthalene;1,4-BCN;Naphthalene, 1-bromo-4-chloro-;1-Bromo-4-chloronaphthalene ISO 9001：2015 REACH;1-chloro-4-bromonaphthalene;1-Bromo-4-chIoronaphthaIene |
| CAS: | 53220-82-9 |
| MF: | C10H6BrCl |
| MW: | 241.51 |
| EINECS: | 201-615-9 |
| Product Categories: | |
| Mol File: | 53220-82-9.mol |
|
1-Bromo-4-chloronaphthalene Chemical Properties
| Melting point | 66.5°C |
| Boiling point | 303°C (rough estimate) |
| density | 1.3874 (rough estimate) |
| refractive index | 1.5890 (estimate) |
| storage temp. | Under room temperature, keep away from direct sun light |
| form | Powder |
| color | White |
| InChI | InChI=1S/C10H6BrCl/c11-9-5-6-10(12)8-4-2-1-3-7(8)9/h1-6H |
| InChIKey | WUGJECZACFHDFE-UHFFFAOYSA-N |
| SMILES | C1(Br)=C2C(C=CC=C2)=C(Cl)C=C1 |
Safety Information
1-Bromo-4-chloronaphthalene Usage And Synthesis
| Uses | 1-Bromo-4-chloronaphthalene is an organic electroluminescent material that is a by-product of the OLED production process and can be used to make OLED displays, electronic components and electronic devices. |
1-Bromo-4-chloronaphthalene Preparation Products And Raw materials
| Raw materials | 4-chloronaphthalene-1-sulfonic acid-->Methanesulfonic acid, 1,1,1-trifluoro-, 4-chloro-1-naphthalenyl ester-->1-AMINO-4-CHLORONAPHTHALENE-->4-Bromonaphthalene-1-sulfonic acid-->4-Bromo-1-naphthylamine-->Carbon tetrachloride-->1-Bromonaphthalene-->1-Chloronaphthalene |
| Preparation Products | 1,4-dibromonaphthalene |
