Introduction：Basic information about 1-broMo-5-fluoro-2-Methyl-4-nitrobenzene CAS 64695-96-1, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
1-broMo-5-fluoro-2-Methyl-4-nitrobenzene Basic information
| Product Name: | 1-broMo-5-fluoro-2-Methyl-4-nitrobenzene |
| Synonyms: | 1-broMo-5-fluoro-2-Methyl-4-nitrobenzene;2-BroMo-4-fluoro-5-nitrotoluene;2-Bromo-4-fluor-5-nitrotoluene;1-broMo-5-fluoro-2-Methyl-4-nitr;Benzene, 1-bromo-5-fluoro-2-methyl-4-nitro- |
| CAS: | 64695-96-1 |
| MF: | C7H5BrFNO2 |
| MW: | 234.02 |
| EINECS: | |
| Product Categories: | |
| Mol File: | 64695-96-1.mol |
|
1-broMo-5-fluoro-2-Methyl-4-nitrobenzene Chemical Properties
| Boiling point | 287.8±35.0 °C(Predicted) |
| density | 1.696±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| Appearance | Light yellow to yellow Solid |
| InChI | InChI=1S/C7H5BrFNO2/c1-4-2-7(10(11)12)6(9)3-5(4)8/h2-3H,1H3 |
| InChIKey | RYWJXYWJUJFEMD-UHFFFAOYSA-N |
| SMILES | C1(Br)=CC(F)=C([N+]([O-])=O)C=C1C |
Safety Information
1-broMo-5-fluoro-2-Methyl-4-nitrobenzene Usage And Synthesis
1-broMo-5-fluoro-2-Methyl-4-nitrobenzene Preparation Products And Raw materials
| Raw materials | 2-Bromo-4-fluorotoluene |
| Preparation Products | 4-(5-isopropoxy-2-Methyl-4-nitrophenyl)pyridine |
