Introduction：Basic information about 1-Chloro anthraquinone CAS 82-44-0, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
1-Chloro anthraquinone Basic information
| Product Name: | 1-Chloro anthraquinone |
| Synonyms: | TIMTEC-BB SBB000825;1-CHLOROANTHRACENE-9,10-DIONE;1-CHLOROANTHRAQUINONE;1-CHLORO AQ;1-chloro-9,10-anthracenedione;.alpha.-Chloroanthraquinone;10-Anthracenedione,1-chloro-9;1-Chloranthrachinon |
| CAS: | 82-44-0 |
| MF: | C14H7ClO2 |
| MW: | 242.66 |
| EINECS: | 201-421-4 |
| Product Categories: | API Intermediate;Intermediates of Dyes and Pigments;Anthraquinones;Chloroanthraquine, etc.;C13 to C14;Carbonyl Compounds;Ketones |
| Mol File: | 82-44-0.mol |
|
1-Chloro anthraquinone Chemical Properties
| Melting point | 159-160 °C (lit.) |
| Boiling point | 345.65°C (rough estimate) |
| density | 1.2377 (rough estimate) |
| refractive index | 1.5380 (estimate) |
| storage temp. | Store below +30°C. |
| solubility | Soluble in hot toluene. (almost transparency) |
| form | Powder or Chunks |
| color | Light yellow to yellow |
| BRN | 1912752 |
| InChI | InChI=1S/C14H7ClO2/c15-11-7-3-6-10-12(11)14(17)9-5-2-1-4-8(9)13(10)16/h1-7H |
| InChIKey | BOCJQSFSGAZAPQ-UHFFFAOYSA-N |
| SMILES | C1(Cl)=C2C(C(=O)C3=C(C2=O)C=CC=C3)=CC=C1 |
| CAS DataBase Reference | 82-44-0(CAS DataBase Reference) |
| NIST Chemistry Reference | 9,10-Anthracenedione, 1-chloro-(82-44-0) |
| EPA Substance Registry System | 1-Chloroanthraquinone (82-44-0) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39-24/25 |
| WGK Germany | 3 |
| RTECS | CB6150000 |
| TSCA | TSCA listed |
| HS Code | 29147090 |
| Storage Class | 11 - Combustible Solids |
| Hazardous Substances Data | 82-44-0(Hazardous Substances Data) |
| Toxicity | LD50 orally in Rabbit: 15100 mg/kg |
1-Chloro anthraquinone Usage And Synthesis
| Chemical Properties | light yellow to yellow powder or chunks |
| Uses | 1-Chloroanthraquinone is an intermediate for manufacturing vat dyes such as CI Vat Brown 1. |
| Uses | 1-Chloroanthraquinone is used to characterize anthraquinone intercalators as carrier molecules for second-generation platinum anticancer drugs. |
| Safety Profile | Poison by intravenous route. An eye irritant. When heated to decomposition it emits very toxic fumes of Cland NOx. |
1-Chloro anthraquinone Preparation Products And Raw materials
| Raw materials | Sodium sulfite-->Sodium chlorate-->Anthraquinone-->1-Anthraquinonesulfonic acid sodium salt-->9(10H)-Anthracenone, 4-chloro--->1-Anthracenecarboxylic acid, 4-chloro-9,10-dihydro-9,10-dioxo--->2-Benzoyl-3-chlorobenzoic acid-->1-chloroanthracen-9(10H)-one-->potassium 9,10-dihydro-9,10-dioxoanthracene-1-sulphonate-->o-Phenanthroline monohydrochloride monohydrate-->1,5-DICHLOROANTHRAQUINONE-->3-Chloro-N-phenylbenzaMide, 97%-->3-CHLOROPHTHALIC ANHYDRIDE |
| Preparation Products | VAT BLACK 27-->Vat Orange 11-->Vat Brown 1-->6,10,12-trichloronaphth[2,3-c]acridine-5,8,14(13H)-trione-->Disperse Red 9-->Vat Orange 16-->1,9-Pyrazoloanthrone-->6,10,12-trichloronaphth[2,3-c]acridine-5,8,14(13H)-trione-->Solvent Red 138 |
