Introduction：Basic information about 1-Chlorobutanone CAS 616-27-3, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
1-Chlorobutanone Basic information
| Product Name: | 1-Chlorobutanone |
| Synonyms: | 1-CHLOROBUTANONE;1-CL-MEK;1-chlorobutan-2-one;1-Chlorobutane-2-one;2-Butanone, 1-chloro-;Serine Impurity 8 |
| CAS: | 616-27-3 |
| MF: | C4H7ClO |
| MW: | 106.55 |
| EINECS: | 210-473-7 |
| Product Categories: | |
| Mol File: | 616-27-3.mol |
|
1-Chlorobutanone Chemical Properties
| Boiling point | 118.37°C (rough estimate) |
| density | 1.0850 |
| refractive index | 1.4372 (estimate) |
| InChI | InChI=1S/C4H7ClO/c1-2-4(6)3-5/h2-3H2,1H3 |
| InChIKey | AALRHBLMAVGWRR-UHFFFAOYSA-N |
| SMILES | C(Cl)C(=O)CC |
| CAS DataBase Reference | 616-27-3 |
Safety Information
1-Chlorobutanone Usage And Synthesis
| Uses | 1-Chlorobutan-2-one can be useful in enantioselective and photoenzymic preparation of α-tertiary amines via flavin-dependent ene-reductases catalyzed radical cyclization of oximes. |
1-Chlorobutanone Preparation Products And Raw materials
| Preparation Products | (2,4-DIOXO-1,3-THIAZOLIDIN-3-YL)ACETIC ACID |
