Introduction：Basic information about 2-(2-BroMophenyl)-9H-phenylcarbazole CAS 1616607-88-5, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
2-(2-BroMophenyl)-9H-phenylcarbazole Basic information
| Product Name: | 2-(2-BroMophenyl)-9H-phenylcarbazole |
| Synonyms: | 2-(2-BroMophenyl)-9H-phenylcarbazole;2-(2-Bromophenyl)-9-phenylcarbazole;9H-Carbazole, 2-(2-bromophenyl)-9-phenyl-;B871247 2-(2-Bromophenyl)-9-phenyl-9H-carbazole,98% |
| CAS: | 1616607-88-5 |
| MF: | C24H16BrN |
| MW: | 398.29 |
| EINECS: | |
| Product Categories: | OLED |
| Mol File: | 1616607-88-5.mol |
|
2-(2-BroMophenyl)-9H-phenylcarbazole Chemical Properties
| Melting point | 104.0 to 108.0 °C |
| Boiling point | 550.1±32.0 °C(Predicted) |
| density | 1.32±0.1 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| color | White to Light yellow |
| InChI | InChI=1S/C24H16BrN/c25-22-12-6-4-10-19(22)17-14-15-21-20-11-5-7-13-23(20)26(24(21)16-17)18-8-2-1-3-9-18/h1-16H |
| InChIKey | DUNRZHFGIQTWFF-UHFFFAOYSA-N |
| SMILES | N1(C2=CC=CC=C2)C2=C(C=CC=C2)C2=C1C=C(C1=CC=CC=C1Br)C=C2 |
Safety Information
2-(2-BroMophenyl)-9H-phenylcarbazole Usage And Synthesis
| Uses | 2-(2-BroMophenyl)-9H-phenylcarbazole can be used as a pharmaceutical intermediate in pharmaceutical synthesis and experimental research. |
2-(2-BroMophenyl)-9H-phenylcarbazole Preparation Products And Raw materials
