Introduction：Basic information about 2,3,4,5-Tetrafluoroaniline CAS 5580-80-3, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
Table of Contents
- 1. 2,3,4,5-Tetrafluoroaniline Basic information
- 2. 2,3,4,5-Tetrafluoroaniline Chemical Properties
- 3. Safety Information
- 4. 2,3,4,5-Tetrafluoroaniline Usage And Synthesis
- 5. 2,3,4,5-Tetrafluoroaniline Preparation Products And Raw materials
2,3,4,5-Tetrafluoroaniline Basic information
| Product Name: | 2,3,4,5-Tetrafluoroaniline |
| Synonyms: | 2,3,4,5-Tetrafluoroa;2,3,4,5-tetrafluoroethane aniline;Benzenamine, 2,3,4,5-tetrafluoro-;2,3,4,5-TETRAFLUOROANILINE;2,3,4,5-TETRAFLUORO-PHENYLAMINE;Aniline, 2,3,4,5-tetrafluoro-;4-flurophenylacetic acid;2,3,4,5-Tetrafluoroaniline 98% |
| CAS: | 5580-80-3 |
| MF: | C6H3F4N |
| MW: | 165.09 |
| EINECS: | 276-218-7 |
| Product Categories: | Aniline;Amines;C2 to C6;Nitrogen Compounds |
| Mol File: | 5580-80-3.mol |
|
2,3,4,5-Tetrafluoroaniline Chemical Properties
| Melting point | 27-29 °C(lit.) |
| Boiling point | 78 °C13 mm Hg(lit.) |
| density | 1.4700 (estimate) |
| refractive index | 1.4670 to 1.4710 |
| Fp | 175 °F |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| pka | 1.23±0.10(Predicted) |
| form | Powder |
| color | White to brown |
| InChI | InChI=1S/C6H3F4N/c7-2-1-3(11)5(9)6(10)4(2)8/h1H,11H2 |
| InChIKey | BEECAQIHCYTZHC-UHFFFAOYSA-N |
| SMILES | C1(N)=CC(F)=C(F)C(F)=C1F |
| CAS DataBase Reference | 5580-80-3(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzenamine, 2,3,4,5-tetrafluoro-(5580-80-3) |
Safety Information
| Hazard Codes | Xi,T |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-27-36/37/39 |
| RIDADR | 2810 |
| WGK Germany | 3 |
| Hazard Note | Toxic |
| HazardClass | IRRITANT, IRRITANT-HARMFUL |
| HazardClass | 6.1 |
| PackingGroup | Ⅲ |
| HS Code | 2921420090 |
2,3,4,5-Tetrafluoroaniline Usage And Synthesis
2,3,4,5-Tetrafluoroaniline Preparation Products And Raw materials
