2,3,4-TRICHLORONITROBENZENE CAS 17700-09-3
Introduction：Basic information about 2,3,4-TRICHLORONITROBENZENE CAS 17700-09-3, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
2,3,4-TRICHLORONITROBENZENE Basic information
| Product Name: | 2,3,4-TRICHLORONITROBENZENE |
| Synonyms: | TIMTEC-BB SBB009919;1,2,3-Trichloronitrobenzene;2,3,4-Trichloro-1-nitrobenzene;4-nitro-1,2,3-trichloro-benzen;4-Nitro-1,2,3-trichlorobenzene;Benzene, 1,2,3-trichloro-4-nitro-;Benzene, 4-nitro-1,2,3-trichloro-;1,2,3-TRICHLORO-4-NITROBENZENE |
| CAS: | 17700-09-3 |
| MF: | C6H2Cl3NO2 |
| MW: | 226.44 |
| EINECS: | 241-705-5 |
| Product Categories: | Nitro Compounds;Nitrogen Compounds;Organic Building Blocks;Building Blocks;Chemical Synthesis;Nitro Compounds;Nitrogen Compounds;Organic Building Blocks |
| Mol File: | 17700-09-3.mol |
2,3,4-TRICHLORONITROBENZENE Chemical Properties
| Melting point | 53-56 °C(lit.) |
| Boiling point | 296.2±35.0 °C(Predicted) |
| density | 1.7193 (rough estimate) |
| refractive index | 1.6300 (estimate) |
| Fp | >230 °F |
| storage temp. | 2-8°C |
| form | powder to crystal |
| color | White to Light yellow to Green |
| Water Solubility | 26.04mg/L(20 ºC) |
| BRN | 2211951 |
| InChI | InChI=1S/C6H2Cl3NO2/c7-3-1-2-4(10(11)12)6(9)5(3)8/h1-2H |
| InChIKey | BGKIECJVXXHLDP-UHFFFAOYSA-N |
| SMILES | C1(Cl)=CC=C([N+]([O-])=O)C(Cl)=C1Cl |
| CAS DataBase Reference | 17700-09-3(CAS DataBase Reference) |
| EPA Substance Registry System | 1,2,3-Trichloro-4-nitrobenzene (17700-09-3) |
Safety Information
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-37/39-36/37 |
| RIDADR | UN 1578 6.1/PG 2 |
| WGK Germany | 3 |
| RTECS | DA6612000 |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29049095 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Toxicity | mic-sat 410 mLg/plate MUREAV 116,217,1983 |
| Chemical Properties | white to light yellow crystal powder |
| Uses | 2,3,4-Trichloronitrobenzene is a useful synthetic intermediate that is mainly used as the starting material in the synthesis of third generation quinolone antibacterial drugs, such as Lomefloxacin (L469415, HCl) and Ofloxacin (O245750). 2,3,4-Trichloronitrobenzene is also used as the starting material in the synthesis of Aclonifen (A190200); a compound used as a pesticide and herbicide. |
| General Description | Needles or light yellow fluffy solid. |
| Air & Water Reactions | Insoluble in water. |
| Reactivity Profile | 2,3,4-TRICHLORONITROBENZENE is incompatible with strong bases and strong oxidizing agents. |
| Fire Hazard | Flash point data for 2,3,4-TRICHLORONITROBENZENE are not available. 2,3,4-TRICHLORONITROBENZENE is probably combustible. |
| Safety Profile | Mutation data reported. Whenheated to decomposition it emits toxic vapors of NOx andClí. |
2,3,4-TRICHLORONITROBENZENE Preparation Products And Raw materials
| Preparation Products | RUFLOXACIN-->3,4-Dichloro-1,2-benzenediamine-->1H-Benzimidazole, 2,6,7-trichloro- |
