Introduction：Basic information about 2,3,4-Trifluorobenzyl bromide CAS 157911-55-2, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
2,3,4-Trifluorobenzyl bromide Basic information
| Product Name: | 2,3,4-Trifluorobenzyl bromide |
| Synonyms: | 2,3,4-TRIFLUOROBENZYL BROMIDE;6-(BROMOMETHYL)-1,2,3-TRIFLUOROBENZENE;ALPHA-BROMO-2,3,4-TRIFLUOROTOLUENE;1-(bromomethyl)-2,3,4-trifluorobenzene;à-bromo-2,3,4-trifluorotoluene;2,3,4-Trifluorobenzyl bromide 97%;2,3,4-Trifluorobenzylbromide97%;Benzene, 1-(bromomethyl)-2,3,4-trifluoro- |
| CAS: | 157911-55-2 |
| MF: | C7H4BrF3 |
| MW: | 225.01 |
| EINECS: | 624-279-9 |
| Product Categories: | Fluorine series;Aryl;C7;Halogenated Hydrocarbons |
| Mol File: | 157911-55-2.mol |
|
2,3,4-Trifluorobenzyl bromide Chemical Properties
| Boiling point | 191.4±35.0 °C(Predicted) |
| density | 1.710 g/mL at 25 °C(lit.) |
| refractive index | n20/D 1.5070(lit.) |
| Fp | 195 °F |
| storage temp. | Inert atmosphere,2-8°C |
| form | Liquid |
| color | Clear colorless to pale yellow |
| Sensitive | Lachrymatory |
| BRN | 8762822 |
| InChI | InChI=1S/C7H4BrF3/c8-3-4-1-2-5(9)7(11)6(4)10/h1-2H,3H2 |
| InChIKey | DGSXDQVPGXFOAN-UHFFFAOYSA-N |
| SMILES | C1(CBr)=CC=C(F)C(F)=C1F |
| CAS DataBase Reference | 157911-55-2(CAS DataBase Reference) |
Safety Information
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-27-36/37/39-45 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Corrosive/Lachrymatory |
| TSCA | T |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29039990 |
2,3,4-Trifluorobenzyl bromide Usage And Synthesis
| Chemical Properties | Colorless liquid |
2,3,4-Trifluorobenzyl bromide Preparation Products And Raw materials
