Introduction：Basic information about 2,3,5-TRIIODOBENZALDEHYDE CAS 477534-99-9, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
2,3,5-TRIIODOBENZALDEHYDE Basic information
| Product Name: | 2,3,5-TRIIODOBENZALDEHYDE |
| Synonyms: | 2,3,5-TRIIODOBENZALDEHYDE;2,3,5-TRIIODOBENZALDEHYDE（WS204086）;Benzaldehyde, 2,3,5-triiodo- |
| CAS: | 477534-99-9 |
| MF: | C7H3I3O |
| MW: | 483.81 |
| EINECS: | |
| Product Categories: | |
| Mol File: | Mol File |
|
2,3,5-TRIIODOBENZALDEHYDE Chemical Properties
| Melting point | 134-138 °C |
| Boiling point | 413.1±45.0 °C(Predicted) |
| density | 2.891±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| Appearance | Off-white to light brown Solid |
| InChI | InChI=1S/C7H3I3O/c8-5-1-4(3-11)7(10)6(9)2-5/h1-3H |
| InChIKey | ROJLASMOZHOOOX-UHFFFAOYSA-N |
| SMILES | C(=O)C1=CC(I)=CC(I)=C1I |
Safety Information
2,3,5-TRIIODOBENZALDEHYDE Usage And Synthesis
| Uses | 2,3,5-Triiodobenzaldehyde is a halogenated benzaldehyde compound in which the hydrogen atoms at the 2, 3, and 5 positions of the benzene ring are replaced by iodine atoms. It can be used to prepare other halogenated compounds through substitution reactions. |
2,3,5-TRIIODOBENZALDEHYDE Preparation Products And Raw materials
