Introduction：Basic information about 2,5-Difluorobenzyl bromide CAS 85117-99-3, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
2,5-Difluorobenzyl bromide Basic information
| Product Name: | 2,5-Difluorobenzyl bromide |
| Synonyms: | ALPHA-BROMO-2,5-DIFLUOROTOLUENE;2,5-DIFLUOROBENZYL BROMIDE;2-(Bromomethyl)-1,4-difluorobenzene;Benzene, 2-(bromomethyl)-1,4-difluoro-;TIMTEC-BB SBB006680;à-bromo-2,5-difluorotoluene;α-bromo-2,5-difluorotoluene;2,5-Difluorobenzyl bromide 98% |
| CAS: | 85117-99-3 |
| MF: | C7H5BrF2 |
| MW: | 207.02 |
| EINECS: | 285-651-0 |
| Product Categories: | Benzhydrols, Benzyl & Special Alcohols;Fluoro-contained benzyl bromide series;Miscellaneous;Fluorinated benzene series;Fluorine series |
| Mol File: | 85117-99-3.mol |
|
2,5-Difluorobenzyl bromide Chemical Properties
| Boiling point | 28 °C |
| density | 1.609 g/mL at 25 °C(lit.) |
| refractive index | n20/D 1.526(lit.) |
| Fp | 60 °F |
| storage temp. | Inert atmosphere,2-8°C |
| form | clear liquid |
| color | Colorless to Light orange to Yellow |
| Specific Gravity | 1.6090 |
| BRN | 7089248 |
| InChI | InChI=1S/C7H5BrF2/c8-4-5-3-6(9)1-2-7(5)10/h1-3H,4H2 |
| InChIKey | ONWGSWNHQZYCFK-UHFFFAOYSA-N |
| SMILES | C1(F)=CC=C(F)C=C1CBr |
| CAS DataBase Reference | 85117-99-3(CAS DataBase Reference) |
| NIST Chemistry Reference | 2,5-Difluorobenzyl bromide(85117-99-3) |
Safety Information
| Hazard Codes | F,C,Xi |
| Risk Statements | 11-34-22-36 |
| Safety Statements | 26-36/37/39-45-16 |
| RIDADR | UN 2924 3/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Corrosive/Lachrymatory |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29039990 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Flam. Liq. 2
Skin Corr. 1B |
2,5-Difluorobenzyl bromide Usage And Synthesis
| Chemical Properties | CLEAR YELLOW LIQUID |
| Uses | 2,5-Difluorobenzyl bromide has been used in the synthesis of:
- novel series of 4-aryl, 4-phenylsulfonyl cyclohexananone-derived γ-secretase inhibitors, for the potential treatment of Alzheimer′s disease
- sulfonamide, amide and acyclic amine derivatives
|
2,5-Difluorobenzyl bromide Preparation Products And Raw materials
| Preparation Products | cis-4-[(4-Chlorophenyl)sulfonyl]-4-(2,5-difluorophenyl)cyclohexanepropanoic acid-->4-[(2,5-difluorophenyl)methoxy]benzaldehyde-->(4-chlorophenyl)(2,5-difluorobenzyl)sulfane |
