Introduction：Basic information about 2,6-Difluorobenzyl bromide CAS 85118-00-9, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
2,6-Difluorobenzyl bromide Basic information
| Product Name: | 2,6-Difluorobenzyl bromide |
| Synonyms: | 2-BROMOMETHYL-1,3-DIFLUORO-BENZENE;2,6-DIFLUOROBENZYL BROMIDE;TIMTEC-BB SBB006564;ALPHA-BROMO-2,6-DIFLUOROTOLUENE;à-bromo-2,6-difluorotoluene;α-bromo-2,6-difluorotoluene;2,6-Difluorobenzyl bromide 98%;2,6-Difluorobenzylbromide98% |
| CAS: | 85118-00-9 |
| MF: | C7H5BrF2 |
| MW: | 207.02 |
| EINECS: | 285-652-6 |
| Product Categories: | Aromatic Halides (substituted);Miscellaneous;Fluoro-contained benzyl bromide series |
| Mol File: | 85118-00-9.mol |
|
2,6-Difluorobenzyl bromide Chemical Properties
| Melting point | 52-55 °C(lit.) |
| Boiling point | 184.9±25.0 °C(Predicted) |
| density | 1,6 g/cm3 |
| refractive index | 1.5256 (estimate) |
| Fp | >230 °F |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | soluble in Methanol |
| form | Crystalline Powder |
| color | Almost white to light beige |
| Sensitive | Lachrymatory |
| BRN | 2083943 |
| InChI | InChI=1S/C7H5BrF2/c8-4-5-6(9)2-1-3-7(5)10/h1-3H,4H2 |
| InChIKey | LSXJPJGBWSZHTM-UHFFFAOYSA-N |
| SMILES | C1(F)=CC=CC(F)=C1CBr |
| CAS DataBase Reference | 85118-00-9(CAS DataBase Reference) |
Safety Information
| Hazard Codes | C |
| Risk Statements | 34-36 |
| Safety Statements | 26-36/37/39-45-25-27 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| F | 10-19-21 |
| Hazard Note | Corrosive/Lachrymatory |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29039990 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1
Skin Corr. 1B |
2,6-Difluorobenzyl bromide Usage And Synthesis
| Chemical Properties | white to light yellow crystal powder |
| Uses | 2,6-Difluorobenzyl bromide has been used:
- as reagent in alkylation of the quinazoline-2-thioxo-4-one
- in the synthesis of 1,3,5-triazine-2,4,6-triones
- in the preparation of new classes of inhibitors of bovine viral diarrhea virus (as a surrogate virus for hepatitis C virus)
|
2,6-Difluorobenzyl bromide Preparation Products And Raw materials
| Raw materials | 2,6-Difluorobenzyl alcohol-->2,6-Difluorotoluene-->Benzoic acid, 3,5-dichloro-2,4,6-trifluoro-, methyl ester-->2,6-Difluorobenzaldehyde-->METHYL 2,6-DIFLUOROBENZOATE |
| Preparation Products | 5-Bromo-1-(2,6-difluorobenzyl)-1H-pyrazole-->Thieno[2,3-d]pyrimidine-2,4(1H,3H)-dione, 1-[(2,6-difluorophenyl)methyl]-5-methyl-6-(4-nitrophenyl)-3-phenyl--->2-acetaMido-3-(2,6-difluorophenyl)propaNAic acid-->ethyl 2-((2,6-difluorobenzyl)(ethoxycarbonyl)amino)-4-methyl-5-(4-nitrophenyl)thiophene-3-carboxylate |
