Introduction：Basic information about 2,6-DIMETHYLBENZONITRILE CAS 6575-13-9, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
2,6-DIMETHYLBENZONITRILE Basic information
| Product Name: | 2,6-DIMETHYLBENZONITRILE |
| Synonyms: | 2-CYANO-M-XYLENE;2,6-DIMETHYLBENZONITRILE;Benzonitrile, 2,6-dimethyl-;2,6-Dimethylbenzoniitrile;2,6-Dimethylbenzonitrile,99%;Carbonitrile 2,6-dimethylphenoxy |
| CAS: | 6575-13-9 |
| MF: | C9H9N |
| MW: | 131.17 |
| EINECS: | 229-503-5 |
| Product Categories: | Aromatic Nitriles |
| Mol File: | 6575-13-9.mol |
|
2,6-DIMETHYLBENZONITRILE Chemical Properties
| Melting point | 88-91 °C |
| Boiling point | 93°C/10mmHg(lit.) |
| density | 1.0111 (estimate) |
| refractive index | 1.5250 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| form | Crystalline Powder |
| color | Beige |
| λmax | 231nm(EtOH)(lit.) |
| BRN | 1932523 |
| InChI | InChI=1S/C9H9N/c1-7-4-3-5-8(2)9(7)6-10/h3-5H,1-2H3 |
| InChIKey | QSACPWSIIRFHHR-UHFFFAOYSA-N |
| SMILES | C(#N)C1=C(C)C=CC=C1C |
| CAS DataBase Reference | 6575-13-9(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22 |
| Safety Statements | 36/37/39-26 |
| RIDADR | 3439 |
| Hazard Note | Harmful |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29269095 |
2,6-DIMETHYLBENZONITRILE Usage And Synthesis
| Chemical Properties | beige crystalline powder |
| Uses | The presence of the cyano group imparts notable chemical reactivity, making 2,6-DIMETHYLBENZONITRILE useful in various organic synthesis applications, including the production of pharmaceuticals and agrochemicals. |
| Agricultural Uses | 2,6-Dimethylbenzonitrile is used in weed science as a herbicide and plant growth regulator. 2,6-Dimethylbenzonitrile inhibits the growth of plants by binding to the active site of photosynthesis and inhibiting electron transport. The mechanism of action is similar to other nitriles such as acetylene. 2,6-Dimethylbenzonitrile also inhibits the production of chlorophylls, which are necessary for photosynthesis. |
2,6-DIMETHYLBENZONITRILE Preparation Products And Raw materials
| Preparation Products | 2,6-DIMETHYLACETOPHENONE |
