Introduction：Basic information about 2,7-Dibromopyrene CAS 102587-98-4, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
2,7-Dibromopyrene Basic information
| Product Name: | 2,7-Dibromopyrene |
| Synonyms: | 2,7-Dibromopyrene;2,7-Dibromopyrene>Pyrene, 2,7-dibromo-;7-Dibromopyrene |
| CAS: | 102587-98-4 |
| MF: | C16H8Br2 |
| MW: | 360.04 |
| EINECS: | 264-769-6 |
| Product Categories: | Electronic Chemicals |
| Mol File: | 102587-98-4.mol |
|
2,7-Dibromopyrene Chemical Properties
| Melting point | 321°C(lit.) |
| Boiling point | 469.6±18.0 °C(Predicted) |
| density | 1.852±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Benzene (Very Slightly, Heated), Chloroform (Very Slightly), DMSO (Very Slightly |
| form | Solid |
| color | Brown |
| InChI | InChI=1S/C16H8Br2/c17-13-5-9-1-2-10-6-14(18)8-12-4-3-11(7-13)15(9)16(10)12/h1-8H |
| InChIKey | IGTQPXMEWQTTBJ-UHFFFAOYSA-N |
| SMILES | C1=C2C3=C4C(C=C2)=CC(Br)=CC4=CC=C3C=C1Br |
Safety Information
2,7-Dibromopyrene Usage And Synthesis
2,7-Dibromopyrene Preparation Products And Raw materials
| Preparation Products | 4,5,9,10-Pyrenetetrone, 2,7-bis(1,1-dimethylethyl)- |
